C38H39BrN2O3 — CID 126554014
tert-butyl 2-[4-[[5-[[(1R)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-5-methylbenzoate (PubChem CID 126554014) has the molecular formula C38H39BrN2O3 and a molecular weight of 651.65 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-[[(1R)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-5-methylbenzoate.
| Compound Name | tert-butyl 2-[4-[[5-[[(1R)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-5-methylbenzoate |
|---|---|
| PubChem CID | 126554014 |
| Molecular Formula | C38H39BrN2O3 |
| Molecular Weight | 651.65 g/mol |
| Exact Mass | 650.21 |
| IUPAC Name | tert-butyl 2-[4-[[5-[[(1R)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]-5-methylbenzoate |
| SMILES | Cc1ccc(-c2ccc(Cn3c(C)c(C)c4cc(C(=O)N[C@H](C)c5ccc(Br)cc5)ccc43)cc2)c(C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C38H39BrN2O3/c1-23-8-18-32(34(20-23)37(43)44-38(5,6)7)29-11-9-27(10-12-29)22-41-26(4)24(2)33-21-30(15-19-35(33)41)36(42)40-25(3)28-13-16-31(39)17-14-28/h8-21,25H,22H2,1-7H3,(H,40,42)/t25-/m1/s1 |
| InChIKey | VIZUYWDSVGEZBY-RUZDIDTESA-N |
| XLogP | 9.49 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.65 |
| LogP ≤ 5 | 9.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|