C33H30BrN3O — CID 118464367
N-[(1S)-1-(4-bromophenyl)ethyl]-1-[[4-(2-methanimidoylphenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 118464367) has the molecular formula C33H30BrN3O and a molecular weight of 564.53 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-1-[[4-(2-methanimidoylphenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-1-[[4-(2-methanimidoylphenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 118464367 |
| Molecular Formula | C33H30BrN3O |
| Molecular Weight | 564.53 g/mol |
| Exact Mass | 563.16 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-1-[[4-(2-methanimidoylphenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | [H]/N=C/c1ccccc1-c1ccc(Cn2c(C)c(C)c3cc(C(=O)N[C@@H](C)c4ccc(Br)cc4)ccc32)cc1 |
| InChI | InChI=1S/C33H30BrN3O/c1-21-23(3)37(20-24-8-10-26(11-9-24)30-7-5-4-6-28(30)19-35)32-17-14-27(18-31(21)32)33(38)36-22(2)25-12-15-29(34)16-13-25/h4-19,22,35H,20H2,1-3H3,(H,36,38)/b35-19+/t22-/m0/s1 |
| InChIKey | BYLGZAAWCNJXJA-FKFOSBRBSA-N |
| XLogP | 8.22 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.53 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|