C35H33BrN2O3 — CID 71099458
ethyl 3-[2-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate (PubChem CID 71099458) has the molecular formula C35H33BrN2O3 and a molecular weight of 609.56 g/mol. Its IUPAC name is ethyl 3-[2-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate.
| Compound Name | ethyl 3-[2-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 71099458 |
| Molecular Formula | C35H33BrN2O3 |
| Molecular Weight | 609.56 g/mol |
| Exact Mass | 608.17 |
| IUPAC Name | ethyl 3-[2-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2ccccc2Cn2c(C)c(C)c3cc(C(=O)N[C@@H](C)c4ccc(Br)cc4)ccc32)c1 |
| InChI | InChI=1S/C35H33BrN2O3/c1-5-41-35(40)28-11-8-10-26(19-28)31-12-7-6-9-29(31)21-38-24(4)22(2)32-20-27(15-18-33(32)38)34(39)37-23(3)25-13-16-30(36)17-14-25/h6-20,23H,5,21H2,1-4H3,(H,37,39)/t23-/m0/s1 |
| InChIKey | OTOKFRDFVDUDGJ-QHCPKHFHSA-N |
| XLogP | 8.40 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.56 |
| LogP ≤ 5 | 8.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|