C35H34N2O2 — CID 71099362
N-[(1S)-1-(3-cyclopropyloxyphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide (PubChem CID 71099362) has the molecular formula C35H34N2O2 and a molecular weight of 514.67 g/mol. Its IUPAC name is N-[(1S)-1-(3-cyclopropyloxyphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide.
| Compound Name | N-[(1S)-1-(3-cyclopropyloxyphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71099362 |
| Molecular Formula | C35H34N2O2 |
| Molecular Weight | 514.67 g/mol |
| Exact Mass | 514.26 |
| IUPAC Name | N-[(1S)-1-(3-cyclopropyloxyphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)N[C@@H](C)c3cccc(OC4CC4)c3)cc12 |
| InChI | InChI=1S/C35H34N2O2/c1-23-25(3)37(22-26-12-14-28(15-13-26)27-8-5-4-6-9-27)34-19-16-30(21-33(23)34)35(38)36-24(2)29-10-7-11-32(20-29)39-31-17-18-31/h4-16,19-21,24,31H,17-18,22H2,1-3H3,(H,36,38)/t24-/m0/s1 |
| InChIKey | LNULFPOQZNSGBX-DEOSSOPVSA-N |
| XLogP | 8.01 |
| TPSA | 43.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.67 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|