C34H31FN2O3 — CID 161240502
carbon dioxide;N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide (PubChem CID 161240502) has the molecular formula C34H31FN2O3 and a molecular weight of 534.63 g/mol. Its IUPAC name is carbon dioxide;N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide.
| Compound Name | carbon dioxide;N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 161240502 |
| Molecular Formula | C34H31FN2O3 |
| Molecular Weight | 534.63 g/mol |
| Exact Mass | 534.23 |
| IUPAC Name | carbon dioxide;N-[(1R)-1-(3-fluoro-4-methylphenyl)ethyl]-2,3-dimethyl-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1ccc([C@@H](C)NC(=O)c2ccc3c(c2)c(C)c(C)n3Cc2ccc(-c3ccccc3)cc2)cc1F.O=C=O |
| InChI | InChI=1S/C33H31FN2O.CO2/c1-21-10-13-28(19-31(21)34)23(3)35-33(37)29-16-17-32-30(18-29)22(2)24(4)36(32)20-25-11-14-27(15-12-25)26-8-6-5-7-9-26;2-1-3/h5-19,23H,20H2,1-4H3,(H,35,37);/t23-;/m1./s1 |
| InChIKey | UZXXUVYCDMOQET-GNAFDRTKSA-N |
| XLogP | 7.33 |
| TPSA | 68.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.63 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|