C35H33F3N2O — CID 71099267
2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1R)-2,2,2-trifluoro-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide (PubChem CID 71099267) has the molecular formula C35H33F3N2O and a molecular weight of 554.66 g/mol. Its IUPAC name is 2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1R)-2,2,2-trifluoro-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1R)-2,2,2-trifluoro-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71099267 |
| Molecular Formula | C35H33F3N2O |
| Molecular Weight | 554.66 g/mol |
| Exact Mass | 554.25 |
| IUPAC Name | 2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[(1R)-2,2,2-trifluoro-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)N[C@H](c3cccc(C(C)C)c3)C(F)(F)F)cc12 |
| InChI | InChI=1S/C35H33F3N2O/c1-22(2)28-11-8-12-29(19-28)33(35(36,37)38)39-34(41)30-17-18-32-31(20-30)23(3)24(4)40(32)21-25-13-15-27(16-14-25)26-9-6-5-7-10-26/h5-20,22,33H,21H2,1-4H3,(H,39,41)/t33-/m1/s1 |
| InChIKey | PCUFWEXROLHTNF-MGBGTMOVSA-N |
| XLogP | 9.13 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.66 |
| LogP ≤ 5 | 9.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|