C36H37N3O2 — CID 71075682
1-[[4-(2-carbamoylphenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide (PubChem CID 71075682) has the molecular formula C36H37N3O2 and a molecular weight of 543.71 g/mol. Its IUPAC name is 1-[[4-(2-carbamoylphenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide.
| Compound Name | 1-[[4-(2-carbamoylphenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71075682 |
| Molecular Formula | C36H37N3O2 |
| Molecular Weight | 543.71 g/mol |
| Exact Mass | 543.29 |
| IUPAC Name | 1-[[4-(2-carbamoylphenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(N)=O)cc2)c2ccc(C(=O)NC(C)c3cccc(C(C)C)c3)cc12 |
| InChI | InChI=1S/C36H37N3O2/c1-22(2)28-9-8-10-29(19-28)24(4)38-36(41)30-17-18-34-33(20-30)23(3)25(5)39(34)21-26-13-15-27(16-14-26)31-11-6-7-12-32(31)35(37)40/h6-20,22,24H,21H2,1-5H3,(H2,37,40)(H,38,41) |
| InChIKey | GJPASUXMVRHPLJ-UHFFFAOYSA-N |
| XLogP | 7.69 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.71 |
| LogP ≤ 5 | 7.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|