C35H34N2O3 — CID 71074845
2-[4-[[5-[1-(2-ethylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71074845) has the molecular formula C35H34N2O3 and a molecular weight of 530.67 g/mol. Its IUPAC name is 2-[4-[[5-[1-(2-ethylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[1-(2-ethylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71074845 |
| Molecular Formula | C35H34N2O3 |
| Molecular Weight | 530.67 g/mol |
| Exact Mass | 530.26 |
| IUPAC Name | 2-[4-[[5-[1-(2-ethylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | CCc1ccccc1C(C)NC(=O)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C35H34N2O3/c1-5-26-10-6-7-11-29(26)23(3)36-34(38)28-18-19-33-32(20-28)22(2)24(4)37(33)21-25-14-16-27(17-15-25)30-12-8-9-13-31(30)35(39)40/h6-20,23H,5,21H2,1-4H3,(H,36,38)(H,39,40) |
| InChIKey | ZWFGBYOUCRKLHM-UHFFFAOYSA-N |
| XLogP | 7.73 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.67 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|