C34H31N3O — CID 71074810
1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-methylphenyl)ethyl]indole-5-carboxamide (PubChem CID 71074810) has the molecular formula C34H31N3O and a molecular weight of 497.64 g/mol. Its IUPAC name is 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-methylphenyl)ethyl]indole-5-carboxamide.
| Compound Name | 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-methylphenyl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71074810 |
| Molecular Formula | C34H31N3O |
| Molecular Weight | 497.64 g/mol |
| Exact Mass | 497.25 |
| IUPAC Name | 1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethyl-N-[1-(4-methylphenyl)ethyl]indole-5-carboxamide |
| SMILES | Cc1ccc(C(C)NC(=O)c2ccc3c(c2)c(C)c(C)n3Cc2ccc(-c3ccccc3C#N)cc2)cc1 |
| InChI | InChI=1S/C34H31N3O/c1-22-9-13-27(14-10-22)24(3)36-34(38)29-17-18-33-32(19-29)23(2)25(4)37(33)21-26-11-15-28(16-12-26)31-8-6-5-7-30(31)20-35/h5-19,24H,21H2,1-4H3,(H,36,38) |
| InChIKey | XFHDYJRPAWKDAF-UHFFFAOYSA-N |
| XLogP | 7.64 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.64 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|