C33H28ClN3O — CID 71074913
N-[1-(2-chlorophenyl)ethyl]-1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 71074913) has the molecular formula C33H28ClN3O and a molecular weight of 518.06 g/mol. Its IUPAC name is N-[1-(2-chlorophenyl)ethyl]-1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | N-[1-(2-chlorophenyl)ethyl]-1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 71074913 |
| Molecular Formula | C33H28ClN3O |
| Molecular Weight | 518.06 g/mol |
| Exact Mass | 517.19 |
| IUPAC Name | N-[1-(2-chlorophenyl)ethyl]-1-[[4-(2-cyanophenyl)phenyl]methyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C#N)cc2)c2ccc(C(=O)NC(C)c3ccccc3Cl)cc12 |
| InChI | InChI=1S/C33H28ClN3O/c1-21-23(3)37(20-24-12-14-25(15-13-24)29-10-5-4-8-27(29)19-35)32-17-16-26(18-30(21)32)33(38)36-22(2)28-9-6-7-11-31(28)34/h4-18,22H,20H2,1-3H3,(H,36,38) |
| InChIKey | SZZWFNJQCDEYQY-UHFFFAOYSA-N |
| XLogP | 7.99 |
| TPSA | 57.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.06 |
| LogP ≤ 5 | 7.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|