C37H36Cl2N2O3 — CID 78008394
tert-butyl 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate (PubChem CID 78008394) has the molecular formula C37H36Cl2N2O3 and a molecular weight of 627.61 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 78008394 |
| Molecular Formula | C37H36Cl2N2O3 |
| Molecular Weight | 627.61 g/mol |
| Exact Mass | 626.21 |
| IUPAC Name | tert-butyl 2-[4-[[5-[1-(2,4-dichlorophenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c2ccc(C(=O)NC(C)c3ccc(Cl)cc3Cl)cc12 |
| InChI | InChI=1S/C37H36Cl2N2O3/c1-22-24(3)41(21-25-11-13-26(14-12-25)30-9-7-8-10-31(30)36(43)44-37(4,5)6)34-18-15-27(19-32(22)34)35(42)40-23(2)29-17-16-28(38)20-33(29)39/h7-20,23H,21H2,1-6H3,(H,40,42) |
| InChIKey | WXITXMHZMDKUCZ-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.61 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|