C36H36BrN3O3 — CID 89251884
tert-butyl 2-[4-[[5-[1-(6-bromo-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate (PubChem CID 89251884) has the molecular formula C36H36BrN3O3 and a molecular weight of 638.61 g/mol. Its IUPAC name is tert-butyl 2-[4-[[5-[1-(6-bromo-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate.
| Compound Name | tert-butyl 2-[4-[[5-[1-(6-bromo-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
|---|---|
| PubChem CID | 89251884 |
| Molecular Formula | C36H36BrN3O3 |
| Molecular Weight | 638.61 g/mol |
| Exact Mass | 637.19 |
| IUPAC Name | tert-butyl 2-[4-[[5-[1-(6-bromo-2-pyridinyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoate |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)OC(C)(C)C)cc2)c2ccc(C(=O)NC(C)c3cccc(Br)n3)cc12 |
| InChI | InChI=1S/C36H36BrN3O3/c1-22-24(3)40(32-19-18-27(20-30(22)32)34(41)38-23(2)31-12-9-13-33(37)39-31)21-25-14-16-26(17-15-25)28-10-7-8-11-29(28)35(42)43-36(4,5)6/h7-20,23H,21H2,1-6H3,(H,38,41) |
| InChIKey | NUSWRXPNJJMMTL-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.61 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|