C33H33N3O2 — CID 89283003
1-[[4-(2-aminophenyl)phenyl]methyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 89283003) has the molecular formula C33H33N3O2 and a molecular weight of 503.65 g/mol. Its IUPAC name is 1-[[4-(2-aminophenyl)phenyl]methyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-[[4-(2-aminophenyl)phenyl]methyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 89283003 |
| Molecular Formula | C33H33N3O2 |
| Molecular Weight | 503.65 g/mol |
| Exact Mass | 503.26 |
| IUPAC Name | 1-[[4-(2-aminophenyl)phenyl]methyl]-N-[(1S)-1-(4-methoxyphenyl)ethyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | COc1ccc([C@H](C)NC(=O)c2ccc3c(c2)c(C)c(C)n3Cc2ccc(-c3ccccc3N)cc2)cc1 |
| InChI | InChI=1S/C33H33N3O2/c1-21-23(3)36(20-24-9-11-26(12-10-24)29-7-5-6-8-31(29)34)32-18-15-27(19-30(21)32)33(37)35-22(2)25-13-16-28(38-4)17-14-25/h5-19,22H,20,34H2,1-4H3,(H,35,37)/t22-/m0/s1 |
| InChIKey | LVPWILAFXOMRBS-QFIPXVFZSA-N |
| XLogP | 7.06 |
| TPSA | 69.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.65 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|