C29H29BrN2O3 — CID 89283451
N-[(1S)-1-(4-bromophenyl)ethyl]-2,3-dimethyl-1-[[3-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]indole-5-carboxamide (PubChem CID 89283451) has the molecular formula C29H29BrN2O3 and a molecular weight of 533.47 g/mol. Its IUPAC name is N-[(1S)-1-(4-bromophenyl)ethyl]-2,3-dimethyl-1-[[3-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2,3-dimethyl-1-[[3-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 89283451 |
| Molecular Formula | C29H29BrN2O3 |
| Molecular Weight | 533.47 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | N-[(1S)-1-(4-bromophenyl)ethyl]-2,3-dimethyl-1-[[3-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2cccc(O[C@@H](C)C=O)c2)c2ccc(C(=O)N[C@@H](C)c3ccc(Br)cc3)cc12 |
| InChI | InChI=1S/C29H29BrN2O3/c1-18(17-33)35-26-7-5-6-22(14-26)16-32-21(4)19(2)27-15-24(10-13-28(27)32)29(34)31-20(3)23-8-11-25(30)12-9-23/h5-15,17-18,20H,16H2,1-4H3,(H,31,34)/t18-,20-/m0/s1 |
| InChIKey | YSJJZGYQHZHDGS-ICSRJNTNSA-N |
| XLogP | 6.53 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.47 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|