C33H38N2O4 — CID 71075177
methyl 2-[3-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]acetate (PubChem CID 71075177) has the molecular formula C33H38N2O4 and a molecular weight of 526.68 g/mol. Its IUPAC name is methyl 2-[3-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]acetate.
| Compound Name | methyl 2-[3-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]acetate |
|---|---|
| PubChem CID | 71075177 |
| Molecular Formula | C33H38N2O4 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.28 |
| IUPAC Name | methyl 2-[3-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenoxy]acetate |
| SMILES | COC(=O)COc1cccc(Cn2c(C)c(C)c3cc(C(=O)NC(C)c4ccc(C(C)(C)C)cc4)ccc32)c1 |
| InChI | InChI=1S/C33H38N2O4/c1-21-23(3)35(19-24-9-8-10-28(17-24)39-20-31(36)38-7)30-16-13-26(18-29(21)30)32(37)34-22(2)25-11-14-27(15-12-25)33(4,5)6/h8-18,22H,19-20H2,1-7H3,(H,34,37) |
| InChIKey | GIKVXTBDRJDMEU-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|