C33H39N3O3 — CID 78002010
1-[[3-(1-amino-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[1-(4-tert-butylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 78002010) has the molecular formula C33H39N3O3 and a molecular weight of 525.69 g/mol. Its IUPAC name is 1-[[3-(1-amino-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[1-(4-tert-butylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-[[3-(1-amino-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[1-(4-tert-butylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 78002010 |
| Molecular Formula | C33H39N3O3 |
| Molecular Weight | 525.69 g/mol |
| Exact Mass | 525.30 |
| IUPAC Name | 1-[[3-(1-amino-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[1-(4-tert-butylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2cccc(OC(C)C(N)=O)c2)c2ccc(C(=O)NC(C)c3ccc(C(C)(C)C)cc3)cc12 |
| InChI | InChI=1S/C33H39N3O3/c1-20-22(3)36(19-24-9-8-10-28(17-24)39-23(4)31(34)37)30-16-13-26(18-29(20)30)32(38)35-21(2)25-11-14-27(15-12-25)33(5,6)7/h8-18,21,23H,19H2,1-7H3,(H2,34,37)(H,35,38) |
| InChIKey | RUFOEXFKOJDODD-UHFFFAOYSA-N |
| XLogP | 6.35 |
| TPSA | 86.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.69 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|