C33H38N2O3 — CID 89283033
2,3-dimethyl-1-[[3-(2-methyl-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide (PubChem CID 89283033) has the molecular formula C33H38N2O3 and a molecular weight of 510.68 g/mol. Its IUPAC name is 2,3-dimethyl-1-[[3-(2-methyl-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide.
| Compound Name | 2,3-dimethyl-1-[[3-(2-methyl-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 89283033 |
| Molecular Formula | C33H38N2O3 |
| Molecular Weight | 510.68 g/mol |
| Exact Mass | 510.29 |
| IUPAC Name | 2,3-dimethyl-1-[[3-(2-methyl-1-oxopropan-2-yl)oxyphenyl]methyl]-N-[(1S)-1-(3-propan-2-ylphenyl)ethyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2cccc(OC(C)(C)C=O)c2)c2ccc(C(=O)N[C@@H](C)c3cccc(C(C)C)c3)cc12 |
| InChI | InChI=1S/C33H38N2O3/c1-21(2)26-11-9-12-27(17-26)23(4)34-32(37)28-14-15-31-30(18-28)22(3)24(5)35(31)19-25-10-8-13-29(16-25)38-33(6,7)20-36/h8-18,20-21,23H,19H2,1-7H3,(H,34,37)/t23-/m0/s1 |
| InChIKey | AXUMLNCEMSLLQR-QHCPKHFHSA-N |
| XLogP | 7.28 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.68 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|