C31H32N2O3 — CID 89283037
N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[3-(2-oxoethoxy)phenyl]methyl]indole-5-carboxamide (PubChem CID 89283037) has the molecular formula C31H32N2O3 and a molecular weight of 480.61 g/mol. Its IUPAC name is N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[3-(2-oxoethoxy)phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[3-(2-oxoethoxy)phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 89283037 |
| Molecular Formula | C31H32N2O3 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethyl-1-[[3-(2-oxoethoxy)phenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2cccc(OCC=O)c2)c2ccc(C(=O)N[C@@H](C)c3cccc(C4CC4)c3)cc12 |
| InChI | InChI=1S/C31H32N2O3/c1-20-22(3)33(19-23-6-4-9-28(16-23)36-15-14-34)30-13-12-27(18-29(20)30)31(35)32-21(2)25-7-5-8-26(17-25)24-10-11-24/h4-9,12-14,16-18,21,24H,10-11,15,19H2,1-3H3,(H,32,35)/t21-/m0/s1 |
| InChIKey | UAAYXJLRJGCNKU-NRFANRHFSA-N |
| XLogP | 6.25 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|