C32H33ClN2O3 — CID 89283164
1-[[3-chloro-4-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]-N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 89283164) has the molecular formula C32H33ClN2O3 and a molecular weight of 529.08 g/mol. Its IUPAC name is 1-[[3-chloro-4-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]-N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-[[3-chloro-4-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]-N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 89283164 |
| Molecular Formula | C32H33ClN2O3 |
| Molecular Weight | 529.08 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 1-[[3-chloro-4-[(2S)-1-oxopropan-2-yl]oxyphenyl]methyl]-N-[(1S)-1-(3-cyclopropylphenyl)ethyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(O[C@@H](C)C=O)c(Cl)c2)c2ccc(C(=O)N[C@@H](C)c3cccc(C4CC4)c3)cc12 |
| InChI | InChI=1S/C32H33ClN2O3/c1-19(18-36)38-31-13-8-23(14-29(31)33)17-35-22(4)20(2)28-16-27(11-12-30(28)35)32(37)34-21(3)25-6-5-7-26(15-25)24-9-10-24/h5-8,11-16,18-19,21,24H,9-10,17H2,1-4H3,(H,34,37)/t19-,21-/m0/s1 |
| InChIKey | RAILNKMDHLHDPE-FPOVZHCZSA-N |
| XLogP | 7.29 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.08 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|