C33H37N3O3 — CID 78008445
2-[[3-[[5-[1-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]methylamino]propanoic acid (PubChem CID 78008445) has the molecular formula C33H37N3O3 and a molecular weight of 523.68 g/mol. Its IUPAC name is 2-[[3-[[5-[1-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]methylamino]propanoic acid.
| Compound Name | 2-[[3-[[5-[1-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]methylamino]propanoic acid |
|---|---|
| PubChem CID | 78008445 |
| Molecular Formula | C33H37N3O3 |
| Molecular Weight | 523.68 g/mol |
| Exact Mass | 523.28 |
| IUPAC Name | 2-[[3-[[5-[1-(3-cyclopropylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]phenyl]methylamino]propanoic acid |
| SMILES | Cc1c(C)n(Cc2cccc(CNC(C)C(=O)O)c2)c2ccc(C(=O)NC(C)c3cccc(C4CC4)c3)cc12 |
| InChI | InChI=1S/C33H37N3O3/c1-20-23(4)36(19-25-8-5-7-24(15-25)18-34-22(3)33(38)39)31-14-13-29(17-30(20)31)32(37)35-21(2)27-9-6-10-28(16-27)26-11-12-26/h5-10,13-17,21-22,26,34H,11-12,18-19H2,1-4H3,(H,35,37)(H,38,39) |
| InChIKey | ZJRLSGIAJAGPON-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 83.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.68 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|