C33H33BrN2O3 — CID 89285676
ethyl 4-[3-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]buta-1,3-dien-2-yl]benzoate (PubChem CID 89285676) has the molecular formula C33H33BrN2O3 and a molecular weight of 585.54 g/mol. Its IUPAC name is ethyl 4-[3-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]buta-1,3-dien-2-yl]benzoate.
| Compound Name | ethyl 4-[3-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]buta-1,3-dien-2-yl]benzoate |
|---|---|
| PubChem CID | 89285676 |
| Molecular Formula | C33H33BrN2O3 |
| Molecular Weight | 585.54 g/mol |
| Exact Mass | 584.17 |
| IUPAC Name | ethyl 4-[3-[[5-[[(1S)-1-(4-bromophenyl)ethyl]carbamoyl]-2,3-dimethylindol-1-yl]methyl]buta-1,3-dien-2-yl]benzoate |
| SMILES | C=C(Cn1c(C)c(C)c2cc(C(=O)N[C@@H](C)c3ccc(Br)cc3)ccc21)C(=C)c1ccc(C(=O)OCC)cc1 |
| InChI | InChI=1S/C33H33BrN2O3/c1-7-39-33(38)27-10-8-25(9-11-27)21(3)20(2)19-36-24(6)22(4)30-18-28(14-17-31(30)36)32(37)35-23(5)26-12-15-29(34)16-13-26/h8-18,23H,2-3,7,19H2,1,4-6H3,(H,35,37)/t23-/m0/s1 |
| InChIKey | PYUZUUKSQAWKSG-QHCPKHFHSA-N |
| XLogP | 7.96 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.54 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|