C33H40N2O4 — CID 123624687
2-[5-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]hexa-1,3,5-trien-3-yloxy]propanoic acid (PubChem CID 123624687) has the molecular formula C33H40N2O4 and a molecular weight of 528.69 g/mol. Its IUPAC name is 2-[5-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]hexa-1,3,5-trien-3-yloxy]propanoic acid.
| Compound Name | 2-[5-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]hexa-1,3,5-trien-3-yloxy]propanoic acid |
|---|---|
| PubChem CID | 123624687 |
| Molecular Formula | C33H40N2O4 |
| Molecular Weight | 528.69 g/mol |
| Exact Mass | 528.30 |
| IUPAC Name | 2-[5-[[5-[1-(4-tert-butylphenyl)ethylcarbamoyl]-2,3-dimethylindol-1-yl]methyl]hexa-1,3,5-trien-3-yloxy]propanoic acid |
| SMILES | C=CC(=CC(=C)Cn1c(C)c(C)c2cc(C(=O)NC(C)c3ccc(C(C)(C)C)cc3)ccc21)OC(C)C(=O)O |
| InChI | InChI=1S/C33H40N2O4/c1-10-28(39-24(6)32(37)38)17-20(2)19-35-23(5)21(3)29-18-26(13-16-30(29)35)31(36)34-22(4)25-11-14-27(15-12-25)33(7,8)9/h10-18,22,24H,1-2,19H2,3-9H3,(H,34,36)(H,37,38) |
| InChIKey | YRFRWXUZHNCYOI-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 80.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.69 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|