C41H46N2O3 — CID 144948531
tert-butyl (2E,5Z)-7-[[2,3-dimethyl-5-[[(1S)-1-naphthalen-2-ylethyl]carbamoyl]indol-1-yl]methyl]-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienoate;molecular hydrogen (PubChem CID 144948531) has the molecular formula C41H46N2O3 and a molecular weight of 614.83 g/mol. Its IUPAC name is tert-butyl (2E,5Z)-7-[[2,3-dimethyl-5-[[(1S)-1-naphthalen-2-ylethyl]carbamoyl]indol-1-yl]methyl]-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienoate;molecular hydrogen.
| Compound Name | tert-butyl (2E,5Z)-7-[[2,3-dimethyl-5-[[(1S)-1-naphthalen-2-ylethyl]carbamoyl]indol-1-yl]methyl]-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienoate;molecular hydrogen |
|---|---|
| PubChem CID | 144948531 |
| Molecular Formula | C41H46N2O3 |
| Molecular Weight | 614.83 g/mol |
| Exact Mass | 614.35 |
| IUPAC Name | tert-butyl (2E,5Z)-7-[[2,3-dimethyl-5-[[(1S)-1-naphthalen-2-ylethyl]carbamoyl]indol-1-yl]methyl]-3,4-dimethylidene-2-prop-2-enylideneocta-5,7-dienoate;molecular hydrogen |
| SMILES | C=C/C=C(\C(=C)C(=C)/C=C\C(=C)Cn1c(C)c(C)c2cc(C(=O)N[C@@H](C)c3ccc4ccccc4c3)ccc21)C(=O)OC(C)(C)C.[H][H] |
| InChI | InChI=1S/C41H44N2O3.H2/c1-11-14-36(40(45)46-41(8,9)10)28(4)27(3)18-17-26(2)25-43-31(7)29(5)37-24-35(21-22-38(37)43)39(44)42-30(6)33-20-19-32-15-12-13-16-34(32)23-33;/h11-24,30H,1-4,25H2,5-10H3,(H,42,44);1H/b18-17-,36-14+;/t30-;/m0./s1 |
| InChIKey | WNBFUQYUKYZEKZ-DVFSYJTESA-N |
| XLogP | 9.83 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.83 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|