C33H29N3O5 — CID 71074718
3-[2-[[2,3-dimethyl-5-[1-(4-nitrophenyl)ethylcarbamoyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 71074718) has the molecular formula C33H29N3O5 and a molecular weight of 547.61 g/mol. Its IUPAC name is 3-[2-[[2,3-dimethyl-5-[1-(4-nitrophenyl)ethylcarbamoyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 3-[2-[[2,3-dimethyl-5-[1-(4-nitrophenyl)ethylcarbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71074718 |
| Molecular Formula | C33H29N3O5 |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.21 |
| IUPAC Name | 3-[2-[[2,3-dimethyl-5-[1-(4-nitrophenyl)ethylcarbamoyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccccc2-c2cccc(C(=O)O)c2)c2ccc(C(=O)NC(C)c3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C33H29N3O5/c1-20-22(3)35(19-27-7-4-5-10-29(27)24-8-6-9-26(17-24)33(38)39)31-16-13-25(18-30(20)31)32(37)34-21(2)23-11-14-28(15-12-23)36(40)41/h4-18,21H,19H2,1-3H3,(H,34,37)(H,38,39) |
| InChIKey | JXLAMCUTTNKCOO-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|