C31H27N3O3 — CID 71099487
3-methyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1-[(4-phenylphenyl)methyl]indole-5-carboxamide (PubChem CID 71099487) has the molecular formula C31H27N3O3 and a molecular weight of 489.58 g/mol. Its IUPAC name is 3-methyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1-[(4-phenylphenyl)methyl]indole-5-carboxamide.
| Compound Name | 3-methyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 71099487 |
| Molecular Formula | C31H27N3O3 |
| Molecular Weight | 489.58 g/mol |
| Exact Mass | 489.21 |
| IUPAC Name | 3-methyl-N-[(1S)-1-(4-nitrophenyl)ethyl]-1-[(4-phenylphenyl)methyl]indole-5-carboxamide |
| SMILES | Cc1cn(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)N[C@@H](C)c3ccc([N+](=O)[O-])cc3)cc12 |
| InChI | InChI=1S/C31H27N3O3/c1-21-19-33(20-23-8-10-26(11-9-23)25-6-4-3-5-7-25)30-17-14-27(18-29(21)30)31(35)32-22(2)24-12-15-28(16-13-24)34(36)37/h3-19,22H,20H2,1-2H3,(H,32,35)/t22-/m0/s1 |
| InChIKey | QQDVRSQAKFLJSO-QFIPXVFZSA-N |
| XLogP | 7.06 |
| TPSA | 77.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.58 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|