C35H35N3O2 — CID 118464375
1-[[4-(2-acetylphenyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2,3-dimethylindole-5-carboxamide (PubChem CID 118464375) has the molecular formula C35H35N3O2 and a molecular weight of 529.68 g/mol. Its IUPAC name is 1-[[4-(2-acetylphenyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2,3-dimethylindole-5-carboxamide.
| Compound Name | 1-[[4-(2-acetylphenyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2,3-dimethylindole-5-carboxamide |
|---|---|
| PubChem CID | 118464375 |
| Molecular Formula | C35H35N3O2 |
| Molecular Weight | 529.68 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 1-[[4-(2-acetylphenyl)phenyl]methyl]-N-[[4-(dimethylamino)phenyl]methyl]-2,3-dimethylindole-5-carboxamide |
| SMILES | CC(=O)c1ccccc1-c1ccc(Cn2c(C)c(C)c3cc(C(=O)NCc4ccc(N(C)C)cc4)ccc32)cc1 |
| InChI | InChI=1S/C35H35N3O2/c1-23-24(2)38(22-27-10-14-28(15-11-27)32-9-7-6-8-31(32)25(3)39)34-19-16-29(20-33(23)34)35(40)36-21-26-12-17-30(18-13-26)37(4)5/h6-20H,21-22H2,1-5H3,(H,36,40) |
| InChIKey | ATMGJUDAAHVTQZ-UHFFFAOYSA-N |
| XLogP | 7.17 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.68 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|