C40H36N2O — CID 89285338
1-[2-[4-[[5-[1-(benzhydrylamino)ethenyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl]ethanone (PubChem CID 89285338) has the molecular formula C40H36N2O and a molecular weight of 560.74 g/mol. Its IUPAC name is 1-[2-[4-[[5-[1-(benzhydrylamino)ethenyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl]ethanone.
| Compound Name | 1-[2-[4-[[5-[1-(benzhydrylamino)ethenyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl]ethanone |
|---|---|
| PubChem CID | 89285338 |
| Molecular Formula | C40H36N2O |
| Molecular Weight | 560.74 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | 1-[2-[4-[[5-[1-(benzhydrylamino)ethenyl]-2,3-dimethylindol-1-yl]methyl]phenyl]phenyl]ethanone |
| SMILES | C=C(NC(c1ccccc1)c1ccccc1)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(-c2ccccc2C(C)=O)cc1 |
| InChI | InChI=1S/C40H36N2O/c1-27-29(3)42(26-31-19-21-32(22-20-31)37-18-12-11-17-36(37)30(4)43)39-24-23-35(25-38(27)39)28(2)41-40(33-13-7-5-8-14-33)34-15-9-6-10-16-34/h5-25,40-41H,2,26H2,1,3-4H3 |
| InChIKey | NJPWYDOYNOUHFZ-UHFFFAOYSA-N |
| XLogP | 9.53 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.74 |
| LogP ≤ 5 | 9.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|