C34H29F3N2O3 — CID 89285546
2-[4-[[2,3-dimethyl-5-[1-[[4-(trifluoromethoxy)phenyl]methylamino]ethenyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 89285546) has the molecular formula C34H29F3N2O3 and a molecular weight of 570.61 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[1-[[4-(trifluoromethoxy)phenyl]methylamino]ethenyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[1-[[4-(trifluoromethoxy)phenyl]methylamino]ethenyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 89285546 |
| Molecular Formula | C34H29F3N2O3 |
| Molecular Weight | 570.61 g/mol |
| Exact Mass | 570.21 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[1-[[4-(trifluoromethoxy)phenyl]methylamino]ethenyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | C=C(NCc1ccc(OC(F)(F)F)cc1)c1ccc2c(c1)c(C)c(C)n2Cc1ccc(-c2ccccc2C(=O)O)cc1 |
| InChI | InChI=1S/C34H29F3N2O3/c1-21-23(3)39(20-25-8-12-26(13-9-25)29-6-4-5-7-30(29)33(40)41)32-17-14-27(18-31(21)32)22(2)38-19-24-10-15-28(16-11-24)42-34(35,36)37/h4-18,38H,2,19-20H2,1,3H3,(H,40,41) |
| InChIKey | JPEZIDWQJMDNRM-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.61 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|