C33H29N3O2 — CID 144948543
2-[4-[[5-[[(4-cyanophenyl)methylamino]methyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 144948543) has the molecular formula C33H29N3O2 and a molecular weight of 499.61 g/mol. Its IUPAC name is 2-[4-[[5-[[(4-cyanophenyl)methylamino]methyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[5-[[(4-cyanophenyl)methylamino]methyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 144948543 |
| Molecular Formula | C33H29N3O2 |
| Molecular Weight | 499.61 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | 2-[4-[[5-[[(4-cyanophenyl)methylamino]methyl]-2,3-dimethylindol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(CNCc3ccc(C#N)cc3)cc12 |
| InChI | InChI=1S/C33H29N3O2/c1-22-23(2)36(21-26-11-14-28(15-12-26)29-5-3-4-6-30(29)33(37)38)32-16-13-27(17-31(22)32)20-35-19-25-9-7-24(18-34)8-10-25/h3-17,35H,19-21H2,1-2H3,(H,37,38) |
| InChIKey | OTLQTZXTEZTLBN-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.61 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|