C32H31N3O2 — CID 123872149
2-[4-[[2,3-dimethyl-5-[(1-pyridin-2-ylethylamino)methyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 123872149) has the molecular formula C32H31N3O2 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[(1-pyridin-2-ylethylamino)methyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[(1-pyridin-2-ylethylamino)methyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 123872149 |
| Molecular Formula | C32H31N3O2 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[(1-pyridin-2-ylethylamino)methyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(CNC(C)c3ccccn3)cc12 |
| InChI | InChI=1S/C32H31N3O2/c1-21-23(3)35(20-24-11-14-26(15-12-24)27-8-4-5-9-28(27)32(36)37)31-16-13-25(18-29(21)31)19-34-22(2)30-10-6-7-17-33-30/h4-18,22,34H,19-20H2,1-3H3,(H,36,37) |
| InChIKey | JXLPZDBXLWJGNC-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|