C35H36N2O2 — CID 144948632
2-[4-[[2,3-dimethyl-5-[[(4-propan-2-ylphenyl)methylamino]methyl]indol-1-yl]methyl]phenyl]benzoic acid (PubChem CID 144948632) has the molecular formula C35H36N2O2 and a molecular weight of 516.69 g/mol. Its IUPAC name is 2-[4-[[2,3-dimethyl-5-[[(4-propan-2-ylphenyl)methylamino]methyl]indol-1-yl]methyl]phenyl]benzoic acid.
| Compound Name | 2-[4-[[2,3-dimethyl-5-[[(4-propan-2-ylphenyl)methylamino]methyl]indol-1-yl]methyl]phenyl]benzoic acid |
|---|---|
| PubChem CID | 144948632 |
| Molecular Formula | C35H36N2O2 |
| Molecular Weight | 516.69 g/mol |
| Exact Mass | 516.28 |
| IUPAC Name | 2-[4-[[2,3-dimethyl-5-[[(4-propan-2-ylphenyl)methylamino]methyl]indol-1-yl]methyl]phenyl]benzoic acid |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3C(=O)O)cc2)c2ccc(CNCc3ccc(C(C)C)cc3)cc12 |
| InChI | InChI=1S/C35H36N2O2/c1-23(2)29-14-9-26(10-15-29)20-36-21-28-13-18-34-33(19-28)24(3)25(4)37(34)22-27-11-16-30(17-12-27)31-7-5-6-8-32(31)35(38)39/h5-19,23,36H,20-22H2,1-4H3,(H,38,39) |
| InChIKey | WIWDHDCZSSARMB-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 54.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.69 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|