C31H29N3O4S — CID 174231881
N-[(3-hydroxyphenyl)methyl]-2,3-dimethyl-1-[[4-(2-sulfamoylphenyl)phenyl]methyl]indole-5-carboxamide (PubChem CID 174231881) has the molecular formula C31H29N3O4S and a molecular weight of 539.66 g/mol. Its IUPAC name is N-[(3-hydroxyphenyl)methyl]-2,3-dimethyl-1-[[4-(2-sulfamoylphenyl)phenyl]methyl]indole-5-carboxamide.
| Compound Name | N-[(3-hydroxyphenyl)methyl]-2,3-dimethyl-1-[[4-(2-sulfamoylphenyl)phenyl]methyl]indole-5-carboxamide |
|---|---|
| PubChem CID | 174231881 |
| Molecular Formula | C31H29N3O4S |
| Molecular Weight | 539.66 g/mol |
| Exact Mass | 539.19 |
| IUPAC Name | N-[(3-hydroxyphenyl)methyl]-2,3-dimethyl-1-[[4-(2-sulfamoylphenyl)phenyl]methyl]indole-5-carboxamide |
| SMILES | Cc1c(C)n(Cc2ccc(-c3ccccc3S(N)(=O)=O)cc2)c2ccc(C(=O)NCc3cccc(O)c3)cc12 |
| InChI | InChI=1S/C31H29N3O4S/c1-20-21(2)34(19-22-10-12-24(13-11-22)27-8-3-4-9-30(27)39(32,37)38)29-15-14-25(17-28(20)29)31(36)33-18-23-6-5-7-26(35)16-23/h3-17,35H,18-19H2,1-2H3,(H,33,36)(H2,32,37,38) |
| InChIKey | CMEQVPMYMZRQHR-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.66 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|