C34H33F3N2O — CID 144948514
2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide;ethane (PubChem CID 144948514) has the molecular formula C34H33F3N2O and a molecular weight of 542.65 g/mol. Its IUPAC name is 2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide;ethane.
| Compound Name | 2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide;ethane |
|---|---|
| PubChem CID | 144948514 |
| Molecular Formula | C34H33F3N2O |
| Molecular Weight | 542.65 g/mol |
| Exact Mass | 542.25 |
| IUPAC Name | 2,3-dimethyl-1-[(4-phenylphenyl)methyl]-N-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carboxamide;ethane |
| SMILES | CC.Cc1c(C)n(Cc2ccc(-c3ccccc3)cc2)c2ccc(C(=O)NCc3cccc(C(F)(F)F)c3)cc12 |
| InChI | InChI=1S/C32H27F3N2O.C2H6/c1-21-22(2)37(20-23-11-13-26(14-12-23)25-8-4-3-5-9-25)30-16-15-27(18-29(21)30)31(38)36-19-24-7-6-10-28(17-24)32(33,34)35;1-2/h3-18H,19-20H2,1-2H3,(H,36,38);1-2H3 |
| InChIKey | LQPMHINMERDGES-UHFFFAOYSA-N |
| XLogP | 8.95 |
| TPSA | 34.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.65 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|