C28H25F3N2O4 — CID 155533929
(2S)-2-[[2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid (PubChem CID 155533929) has the molecular formula C28H25F3N2O4 and a molecular weight of 510.51 g/mol. Its IUPAC name is (2S)-2-[[2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | (2S)-2-[[2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 155533929 |
| Molecular Formula | C28H25F3N2O4 |
| Molecular Weight | 510.51 g/mol |
| Exact Mass | 510.18 |
| IUPAC Name | (2S)-2-[[2,3-dimethyl-1-[[3-(trifluoromethyl)phenyl]methyl]indole-5-carbonyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| SMILES | Cc1c(C)n(Cc2cccc(C(F)(F)F)c2)c2ccc(C(=O)N[C@@H](Cc3ccc(O)cc3)C(=O)O)cc12 |
| InChI | InChI=1S/C28H25F3N2O4/c1-16-17(2)33(15-19-4-3-5-21(12-19)28(29,30)31)25-11-8-20(14-23(16)25)26(35)32-24(27(36)37)13-18-6-9-22(34)10-7-18/h3-12,14,24,34H,13,15H2,1-2H3,(H,32,35)(H,36,37)/t24-/m0/s1 |
| InChIKey | IHOIBWGLUSSODJ-DEOSSOPVSA-N |
| XLogP | 5.46 |
| TPSA | 91.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.51 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|