C17H14F3NO3 — CID 9437907
(2R)-3-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]propanoic acid (PubChem CID 9437907) has the molecular formula C17H14F3NO3 and a molecular weight of 337.30 g/mol. Its IUPAC name is (2R)-3-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]propanoic acid.
| Compound Name | (2R)-3-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 9437907 |
| Molecular Formula | C17H14F3NO3 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.09 |
| IUPAC Name | (2R)-3-phenyl-2-[[3-(trifluoromethyl)benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C17H14F3NO3/c18-17(19,20)13-8-4-7-12(10-13)15(22)21-14(16(23)24)9-11-5-2-1-3-6-11/h1-8,10,14H,9H2,(H,21,22)(H,23,24)/t14-/m1/s1 |
| InChIKey | WEORYTOWYZKZHP-CQSZACIVSA-N |
| XLogP | 3.13 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |