C24H23NO3 — CID 101236602
(2S)-3-phenyl-2-[[3-(2-phenylethyl)benzoyl]amino]propanoic acid (PubChem CID 101236602) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (2S)-3-phenyl-2-[[3-(2-phenylethyl)benzoyl]amino]propanoic acid.
| Compound Name | (2S)-3-phenyl-2-[[3-(2-phenylethyl)benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 101236602 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (2S)-3-phenyl-2-[[3-(2-phenylethyl)benzoyl]amino]propanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)c1cccc(CCc2ccccc2)c1 |
| InChI | InChI=1S/C24H23NO3/c26-23(25-22(24(27)28)17-19-10-5-2-6-11-19)21-13-7-12-20(16-21)15-14-18-8-3-1-4-9-18/h1-13,16,22H,14-15,17H2,(H,25,26)(H,27,28)/t22-/m0/s1 |
| InChIKey | NTLCPRVTMUZTTQ-QFIPXVFZSA-N |
| XLogP | 3.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |