C34H30N2O6 — CID 91827493
(2R)-2-[[4-[(E)-2-[4-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]phenyl]ethenyl]benzoyl]amino]-3-phenylpropanoic acid (PubChem CID 91827493) has the molecular formula C34H30N2O6 and a molecular weight of 562.62 g/mol. Its IUPAC name is (2R)-2-[[4-[(E)-2-[4-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]phenyl]ethenyl]benzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[4-[(E)-2-[4-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]phenyl]ethenyl]benzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 91827493 |
| Molecular Formula | C34H30N2O6 |
| Molecular Weight | 562.62 g/mol |
| Exact Mass | 562.21 |
| IUPAC Name | (2R)-2-[[4-[(E)-2-[4-[[(1S)-1-carboxy-2-phenylethyl]carbamoyl]phenyl]ethenyl]benzoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=C(N[C@@H](Cc1ccccc1)C(=O)O)c1ccc(/C=C/c2ccc(C(=O)N[C@H](Cc3ccccc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C34H30N2O6/c37-31(35-29(33(39)40)21-25-7-3-1-4-8-25)27-17-13-23(14-18-27)11-12-24-15-19-28(20-16-24)32(38)36-30(34(41)42)22-26-9-5-2-6-10-26/h1-20,29-30H,21-22H2,(H,35,37)(H,36,38)(H,39,40)(H,41,42)/b12-11+/t29-,30+ |
| InChIKey | FHPWRVCQEVVUCG-CEGOESPKSA-N |
| XLogP | 4.71 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.62 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|