C26H23FN2O5 — CID 177498272
(2S)-2-[[(2S)-3-(4-fluorophenyl)-2-[(4-formylbenzoyl)amino]propanoyl]amino]-3-phenylpropanoic acid (PubChem CID 177498272) has the molecular formula C26H23FN2O5 and a molecular weight of 462.48 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-(4-fluorophenyl)-2-[(4-formylbenzoyl)amino]propanoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[(2S)-3-(4-fluorophenyl)-2-[(4-formylbenzoyl)amino]propanoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 177498272 |
| Molecular Formula | C26H23FN2O5 |
| Molecular Weight | 462.48 g/mol |
| Exact Mass | 462.16 |
| IUPAC Name | (2S)-2-[[(2S)-3-(4-fluorophenyl)-2-[(4-formylbenzoyl)amino]propanoyl]amino]-3-phenylpropanoic acid |
| SMILES | O=Cc1ccc(C(=O)N[C@@H](Cc2ccc(F)cc2)C(=O)N[C@@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C26H23FN2O5/c27-21-12-8-18(9-13-21)14-22(28-24(31)20-10-6-19(16-30)7-11-20)25(32)29-23(26(33)34)15-17-4-2-1-3-5-17/h1-13,16,22-23H,14-15H2,(H,28,31)(H,29,32)(H,33,34)/t22-,23-/m0/s1 |
| InChIKey | NTXRDICQNVRJEY-GOTSBHOMSA-N |
| XLogP | 2.79 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.48 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|