C17H15FN2O3 — CID 150964230
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-4-fluorobenzamide (PubChem CID 150964230) has the molecular formula C17H15FN2O3 and a molecular weight of 314.32 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-4-fluorobenzamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 150964230 |
| Molecular Formula | C17H15FN2O3 |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-4-fluorobenzamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H15FN2O3/c18-13-8-6-12(7-9-13)17(23)20-14(15(21)16(19)22)10-11-4-2-1-3-5-11/h1-9,14H,10H2,(H2,19,22)(H,20,23)/t14-/m0/s1 |
| InChIKey | LMSVMWWTLJPISY-AWEZNQCLSA-N |
| XLogP | 1.22 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|