C23H20N2O3 — CID 54553924
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-phenylbenzamide (PubChem CID 54553924) has the molecular formula C23H20N2O3 and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-phenylbenzamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-phenylbenzamide |
|---|---|
| PubChem CID | 54553924 |
| Molecular Formula | C23H20N2O3 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-2-phenylbenzamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1ccccc1-c1ccccc1 |
| InChI | InChI=1S/C23H20N2O3/c24-22(27)21(26)20(15-16-9-3-1-4-10-16)25-23(28)19-14-8-7-13-18(19)17-11-5-2-6-12-17/h1-14,20H,15H2,(H2,24,27)(H,25,28)/t20-/m0/s1 |
| InChIKey | ZLVIQUHAKCYTKW-FQEVSTJZSA-N |
| XLogP | 2.75 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|