C21H18N2O4 — CID 142753560
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylfuran-2-carboxamide (PubChem CID 142753560) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylfuran-2-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylfuran-2-carboxamide |
|---|---|
| PubChem CID | 142753560 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-phenylfuran-2-carboxamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1occc1-c1ccccc1 |
| InChI | InChI=1S/C21H18N2O4/c22-20(25)18(24)17(13-14-7-3-1-4-8-14)23-21(26)19-16(11-12-27-19)15-9-5-2-6-10-15/h1-12,17H,13H2,(H2,22,25)(H,23,26)/t17-/m0/s1 |
| InChIKey | BVZMNCARGAHHFV-KRWDZBQOSA-N |
| XLogP | 2.34 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|