C20H18F2N4O4 — CID 155479055
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2-methylfuran-3-yl)pyrazole-4-carboxamide (PubChem CID 155479055) has the molecular formula C20H18F2N4O4 and a molecular weight of 416.38 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2-methylfuran-3-yl)pyrazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2-methylfuran-3-yl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155479055 |
| Molecular Formula | C20H18F2N4O4 |
| Molecular Weight | 416.38 g/mol |
| Exact Mass | 416.13 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2-methylfuran-3-yl)pyrazole-4-carboxamide |
| SMILES | Cc1occc1-c1nn(C(F)F)cc1C(=O)NC(Cc1ccccc1)C(=O)C(N)=O |
| InChI | InChI=1S/C20H18F2N4O4/c1-11-13(7-8-30-11)16-14(10-26(25-16)20(21)22)19(29)24-15(17(27)18(23)28)9-12-5-3-2-4-6-12/h2-8,10,15,20H,9H2,1H3,(H2,23,28)(H,24,29) |
| InChIKey | GWYQRYWLZRTWLF-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.38 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|