C22H17F2N5O4 — CID 155479157
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1,3-benzoxazol-4-yl)-1-(difluoromethyl)pyrazole-4-carboxamide (PubChem CID 155479157) has the molecular formula C22H17F2N5O4 and a molecular weight of 453.41 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1,3-benzoxazol-4-yl)-1-(difluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1,3-benzoxazol-4-yl)-1-(difluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 155479157 |
| Molecular Formula | C22H17F2N5O4 |
| Molecular Weight | 453.41 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-3-(1,3-benzoxazol-4-yl)-1-(difluoromethyl)pyrazole-4-carboxamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cn(C(F)F)nc1-c1cccc2ocnc12 |
| InChI | InChI=1S/C22H17F2N5O4/c23-22(24)29-10-14(17(28-29)13-7-4-8-16-18(13)26-11-33-16)21(32)27-15(19(30)20(25)31)9-12-5-2-1-3-6-12/h1-8,10-11,15,22H,9H2,(H2,25,31)(H,27,32) |
| InChIKey | SRKUDANPSSQXOH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 133.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.41 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|