C23H22F2N4O3 — CID 134397202
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2,5-dimethylphenyl)pyrazole-4-carboxamide (PubChem CID 134397202) has the molecular formula C23H22F2N4O3 and a molecular weight of 440.45 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2,5-dimethylphenyl)pyrazole-4-carboxamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2,5-dimethylphenyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 134397202 |
| Molecular Formula | C23H22F2N4O3 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-1-(difluoromethyl)-3-(2,5-dimethylphenyl)pyrazole-4-carboxamide |
| SMILES | Cc1ccc(C)c(-c2nn(C(F)F)cc2C(=O)NC(Cc2ccccc2)C(=O)C(N)=O)c1 |
| InChI | InChI=1S/C23H22F2N4O3/c1-13-8-9-14(2)16(10-13)19-17(12-29(28-19)23(24)25)22(32)27-18(20(30)21(26)31)11-15-6-4-3-5-7-15/h3-10,12,18,23H,11H2,1-2H3,(H2,26,31)(H,27,32) |
| InChIKey | QKHCRFUCEVTALM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|