C22H19N5O3 — CID 142753771
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-(3-cyanophenyl)-1-methylpyrazole-4-carboxamide (PubChem CID 142753771) has the molecular formula C22H19N5O3 and a molecular weight of 401.43 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-(3-cyanophenyl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-(3-cyanophenyl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142753771 |
| Molecular Formula | C22H19N5O3 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.15 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-3-(3-cyanophenyl)-1-methylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@@H](Cc2ccccc2)C(=O)C(N)=O)c(-c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C22H19N5O3/c1-27-13-17(19(26-27)16-9-5-8-15(10-16)12-23)22(30)25-18(20(28)21(24)29)11-14-6-3-2-4-7-14/h2-10,13,18H,11H2,1H3,(H2,24,29)(H,25,30)/t18-/m0/s1 |
| InChIKey | JTFCVHHFJHOOSE-SFHVURJKSA-N |
| XLogP | 1.35 |
| TPSA | 130.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|