C20H19N3O4 — CID 158752445
N-(3,4-dioxo-1-phenylpentan-2-yl)-3-(furan-3-yl)-1-methylpyrazole-4-carboxamide (PubChem CID 158752445) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is N-(3,4-dioxo-1-phenylpentan-2-yl)-3-(furan-3-yl)-1-methylpyrazole-4-carboxamide.
| Compound Name | N-(3,4-dioxo-1-phenylpentan-2-yl)-3-(furan-3-yl)-1-methylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 158752445 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | N-(3,4-dioxo-1-phenylpentan-2-yl)-3-(furan-3-yl)-1-methylpyrazole-4-carboxamide |
| SMILES | CC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1cn(C)nc1-c1ccoc1 |
| InChI | InChI=1S/C20H19N3O4/c1-13(24)19(25)17(10-14-6-4-3-5-7-14)21-20(26)16-11-23(2)22-18(16)15-8-9-27-12-15/h3-9,11-12,17H,10H2,1-2H3,(H,21,26) |
| InChIKey | FBGOOCLQINBKBK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 94.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|