C19H24N4O3 — CID 142753508
N-[(3S)-1-amino-5,5-dimethyl-1,2-dioxohexan-3-yl]-1-methyl-3-phenylpyrazole-4-carboxamide (PubChem CID 142753508) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is N-[(3S)-1-amino-5,5-dimethyl-1,2-dioxohexan-3-yl]-1-methyl-3-phenylpyrazole-4-carboxamide.
| Compound Name | N-[(3S)-1-amino-5,5-dimethyl-1,2-dioxohexan-3-yl]-1-methyl-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142753508 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | N-[(3S)-1-amino-5,5-dimethyl-1,2-dioxohexan-3-yl]-1-methyl-3-phenylpyrazole-4-carboxamide |
| SMILES | Cn1cc(C(=O)N[C@@H](CC(C)(C)C)C(=O)C(N)=O)c(-c2ccccc2)n1 |
| InChI | InChI=1S/C19H24N4O3/c1-19(2,3)10-14(16(24)17(20)25)21-18(26)13-11-23(4)22-15(13)12-8-6-5-7-9-12/h5-9,11,14H,10H2,1-4H3,(H2,20,25)(H,21,26)/t14-/m0/s1 |
| InChIKey | SIBYTTYAQBTOMS-AWEZNQCLSA-N |
| XLogP | 1.68 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|