C23H22N4O3 — CID 142753814
N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-cyclopropyl-3-phenylpyrazole-4-carboxamide (PubChem CID 142753814) has the molecular formula C23H22N4O3 and a molecular weight of 402.45 g/mol. Its IUPAC name is N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-cyclopropyl-3-phenylpyrazole-4-carboxamide.
| Compound Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-cyclopropyl-3-phenylpyrazole-4-carboxamide |
|---|---|
| PubChem CID | 142753814 |
| Molecular Formula | C23H22N4O3 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | N-[(2S)-4-amino-3,4-dioxo-1-phenylbutan-2-yl]-1-cyclopropyl-3-phenylpyrazole-4-carboxamide |
| SMILES | NC(=O)C(=O)[C@H](Cc1ccccc1)NC(=O)c1cn(C2CC2)nc1-c1ccccc1 |
| InChI | InChI=1S/C23H22N4O3/c24-22(29)21(28)19(13-15-7-3-1-4-8-15)25-23(30)18-14-27(17-11-12-17)26-20(18)16-9-5-2-6-10-16/h1-10,14,17,19H,11-13H2,(H2,24,29)(H,25,30)/t19-/m0/s1 |
| InChIKey | JJKQIWOZDGLENN-IBGZPJMESA-N |
| XLogP | 2.28 |
| TPSA | 107.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|