C17H15BrN2O3 — CID 162475674
N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-bromobenzamide (PubChem CID 162475674) has the molecular formula C17H15BrN2O3 and a molecular weight of 375.22 g/mol. Its IUPAC name is N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-bromobenzamide.
| Compound Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-bromobenzamide |
|---|---|
| PubChem CID | 162475674 |
| Molecular Formula | C17H15BrN2O3 |
| Molecular Weight | 375.22 g/mol |
| Exact Mass | 374.03 |
| IUPAC Name | N-(4-amino-3,4-dioxo-1-phenylbutan-2-yl)-2-bromobenzamide |
| SMILES | NC(=O)C(=O)C(Cc1ccccc1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C17H15BrN2O3/c18-13-9-5-4-8-12(13)17(23)20-14(15(21)16(19)22)10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H2,19,22)(H,20,23) |
| InChIKey | LOOLFQUCWLOZMH-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.22 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|