C17H15NO5 — CID 149148944
2-[[(1R)-1-carboxy-2-phenylethyl]carbamoyl]benzoic acid (PubChem CID 149148944) has the molecular formula C17H15NO5 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[[(1R)-1-carboxy-2-phenylethyl]carbamoyl]benzoic acid.
| Compound Name | 2-[[(1R)-1-carboxy-2-phenylethyl]carbamoyl]benzoic acid |
|---|---|
| PubChem CID | 149148944 |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[[(1R)-1-carboxy-2-phenylethyl]carbamoyl]benzoic acid |
| SMILES | O=C(O)c1ccccc1C(=O)N[C@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C17H15NO5/c19-15(12-8-4-5-9-13(12)16(20)21)18-14(17(22)23)10-11-6-2-1-3-7-11/h1-9,14H,10H2,(H,18,19)(H,20,21)(H,22,23)/t14-/m1/s1 |
| InChIKey | WMYRYTHPUNNJQO-CQSZACIVSA-N |
| XLogP | 1.81 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |